|
|
| | beta-D-Ribofuranose 1-acetate 2,3,5-tribenzoate Basic information |
| Product Name: | beta-D-Ribofuranose 1-acetate 2,3,5-tribenzoate | | Synonyms: | 1-O-Acetyl-2,3,5-tri-O-benzoyl-a,-D-ribofuranose;B-D-RIBOFURANOSE-1-ACETATE-2,3,5-TRIBENZOATE;BETA-D-RIBOFURANOSE 1-ACETATE 2,3,5-TRIBENZOATE;1-O-Acetyl-2-O,3-O,5-O-tribenzoyl-β-D-ribofuranose;2-O,3-O,5-O-Tribenzoyl-1-O-acetyl-β-D-ribofuranose;2-O,3-O,5-O-Tribenzoyl-β-D-ribofuranose 1-acetate;(3R,4R,5R)-2-Acetoxy-3,4-bis(benzoyloxy)-5-(benzoyloxymethyl)tetrahydrofuran;1-0-Acetyl-2,3,5-Tri-0-Benzoyl--D-Ribofuranose | | CAS: | 6974-32-9 | | MF: | C28H24O9 | | MW: | 504.48 | | EINECS: | 230-220-4 | | Product Categories: | 50kg in stock;Carbohydrates;Pharmaceutical Intermediates;chiral;(intermediate of clofarabine);Nucleic acids;Sugars, Carbohydrates & Glucosides;Biochemistry;Nucleosides, Nucleotides & Related Reagents;O-Substituted Sugars;Ribose;Riboses and 2'-Deoxyriboses;Sugars;Inhibitors;Carbohydrates & Derivatives;6974-32-9 | | Mol File: | 6974-32-9.mol |  |
| | beta-D-Ribofuranose 1-acetate 2,3,5-tribenzoate Chemical Properties |
| Melting point | 128-130 °C | | alpha | 24.4 º (c=1, pyridine) | | Boiling point | 621.0±55.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | refractive index | 24 ° (C=1, Pyridine) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly, Sonicated), | | form | Liquid | | color | Clear slightly yellow or greenish to brown | | optical activity | [α]20/D +24.3°, c = 1 in pyridine | | BRN | 100243 | | InChI | InChI=1/C28H24O9/c1-17(29)34-28-24(36-26(31)19-13-7-4-8-14-19)23(35-25(30)18-11-5-3-6-12-18)22(37-28)20-15-9-10-16-21(20)27(32)33-2/h3-16,22-24,28H,1-2H3/t22-,23-,24-,28-/s3 | | InChIKey | GCZABPLTDYVJMP-CBUXHAPBSA-N | | SMILES | C(OC)(=O)C1=CC=CC=C1[C@@H]1[C@@H](OC(=O)C2=CC=CC=C2)[C@@H](OC(=O)C2=CC=CC=C2)[C@H](OC(C)=O)O1 |&1:10,11,21,31,r| | | CAS DataBase Reference | 6974-32-9(CAS DataBase Reference) | | EPA Substance Registry System | .beta.-D-Ribofuranose, 1-acetate 2,3,5-tribenzoate (6974-32-9) |
| | beta-D-Ribofuranose 1-acetate 2,3,5-tribenzoate Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | An inhibitor of neutrophil-keyhole limpet hemocyanin adhesion | | Purification Methods | Recrystallise it from EtOH or isoPrOH. [Helv Chim Acta 42 1171 1959, NMR: J Org Chem 33 1799 1968, IR: Chem Pharm Bull Jpn 11 188 1963, Beilstein 17/6 V 213.] |
| | beta-D-Ribofuranose 1-acetate 2,3,5-tribenzoate Preparation Products And Raw materials |
|